C17H22N2O4S — CID 41476250
N-[(2R)-2-hydroxy-3-[4-(methylamino)phenoxy]propyl]-4-methylbenzenesulfonamide (PubChem CID 41476250) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-[4-(methylamino)phenoxy]propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-[4-(methylamino)phenoxy]propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 41476250 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-[4-(methylamino)phenoxy]propyl]-4-methylbenzenesulfonamide |
| SMILES | CNc1ccc(OC[C@H](O)CNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-13-3-9-17(10-4-13)24(21,22)19-11-15(20)12-23-16-7-5-14(18-2)6-8-16/h3-10,15,18-20H,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | MHHDZGCRGRWPFS-OAHLLOKOSA-N |
| XLogP | 1.75 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|