C19H34ClNO3SSi — CID 134927468
N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-methylpentan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 134927468) has the molecular formula C19H34ClNO3SSi and a molecular weight of 420.09 g/mol. Its IUPAC name is N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-methylpentan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-methylpentan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134927468 |
| Molecular Formula | C19H34ClNO3SSi |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-methylpentan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](Cl)C(C)C)cc1 |
| InChI | InChI=1S/C19H34ClNO3SSi/c1-14(2)18(20)17(13-24-26(7,8)19(4,5)6)21-25(22,23)16-11-9-15(3)10-12-16/h9-12,14,17-18,21H,13H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | OJBVISJSVZKWRU-ZWKOTPCHSA-N |
| XLogP | 4.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|