C22H41NO4SSi — CID 10873927
N-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methylhexan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 10873927) has the molecular formula C22H41NO4SSi and a molecular weight of 443.73 g/mol. Its IUPAC name is N-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methylhexan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methylhexan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 10873927 |
| Molecular Formula | C22H41NO4SSi |
| Molecular Weight | 443.73 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-methylhexan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)CC(C)C)c(C)c1 |
| InChI | InChI=1S/C22H41NO4SSi/c1-15(2)11-20(24)19(14-27-29(9,10)22(6,7)8)23-28(25,26)21-17(4)12-16(3)13-18(21)5/h12-13,15,19-20,23-24H,11,14H2,1-10H3/t19-,20+/m1/s1 |
| InChIKey | PDTWQURAVGXJPN-UXHICEINSA-N |
| XLogP | 4.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|