C18H29NO3SSi — CID 10785209
N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]-4-methylbenzenesulfonamide (PubChem CID 10785209) has the molecular formula C18H29NO3SSi and a molecular weight of 367.59 g/mol. Its IUPAC name is N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10785209 |
| Molecular Formula | C18H29NO3SSi |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-1-yn-3-yl]-4-methylbenzenesulfonamide |
| SMILES | C#C[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO3SSi/c1-9-17(15(3)22-24(7,8)18(4,5)6)19-23(20,21)16-12-10-14(2)11-13-16/h1,10-13,15,17,19H,2-8H3/t15-,17-/m1/s1 |
| InChIKey | DDNRLBVJLGWCDW-NVXWUHKLSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|