C22H34N2O3SSi — CID 10670500
N-[2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-pyridinyl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 10670500) has the molecular formula C22H34N2O3SSi and a molecular weight of 434.68 g/mol. Its IUPAC name is N-[2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-pyridinyl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-pyridinyl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10670500 |
| Molecular Formula | C22H34N2O3SSi |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-pyridinyl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2ccncc2CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H34N2O3SSi/c1-18-7-9-21(10-8-18)28(25,26)24-15-12-19-11-14-23-17-20(19)13-16-27-29(5,6)22(2,3)4/h7-11,14,17,24H,12-13,15-16H2,1-6H3 |
| InChIKey | NFNWUWQAHMOAPG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|