C18H26N2O4S — CID 46704155
(2R)-N-methoxy-N-methyl-2-[(1S)-1-[(4-methylphenyl)sulfonylamino]prop-2-enyl]hex-5-enamide (PubChem CID 46704155) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is (2R)-N-methoxy-N-methyl-2-[(1S)-1-[(4-methylphenyl)sulfonylamino]prop-2-enyl]hex-5-enamide.
| Compound Name | (2R)-N-methoxy-N-methyl-2-[(1S)-1-[(4-methylphenyl)sulfonylamino]prop-2-enyl]hex-5-enamide |
|---|---|
| PubChem CID | 46704155 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2R)-N-methoxy-N-methyl-2-[(1S)-1-[(4-methylphenyl)sulfonylamino]prop-2-enyl]hex-5-enamide |
| SMILES | C=CCC[C@@H](C(=O)N(C)OC)[C@H](C=C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-6-8-9-16(18(21)20(4)24-5)17(7-2)19-25(22,23)15-12-10-14(3)11-13-15/h6-7,10-13,16-17,19H,1-2,8-9H2,3-5H3/t16-,17+/m1/s1 |
| InChIKey | QMRXEKFOZDYPIT-SJORKVTESA-N |
| XLogP | 2.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|