C12H17NO3S — CID 89212205
4-methyl-N-[(1R)-1-[(2R)-oxiran-2-yl]propyl]benzenesulfonamide (PubChem CID 89212205) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-1-[(2R)-oxiran-2-yl]propyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R)-1-[(2R)-oxiran-2-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89212205 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-methyl-N-[(1R)-1-[(2R)-oxiran-2-yl]propyl]benzenesulfonamide |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H]1CO1 |
| InChI | InChI=1S/C12H17NO3S/c1-3-11(12-8-16-12)13-17(14,15)10-6-4-9(2)5-7-10/h4-7,11-13H,3,8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | IUOUJYNWXXVCTO-NEPJUHHUSA-N |
| XLogP | 1.45 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|