C33H39NO2SSi — CID 164685134
4-methyl-N-[1-[methyl(diphenyl)silyl]-1-phenylheptyl]benzenesulfonamide (PubChem CID 164685134) has the molecular formula C33H39NO2SSi and a molecular weight of 541.83 g/mol. Its IUPAC name is 4-methyl-N-[1-[methyl(diphenyl)silyl]-1-phenylheptyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[methyl(diphenyl)silyl]-1-phenylheptyl]benzenesulfonamide |
|---|---|
| PubChem CID | 164685134 |
| Molecular Formula | C33H39NO2SSi |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 4-methyl-N-[1-[methyl(diphenyl)silyl]-1-phenylheptyl]benzenesulfonamide |
| SMILES | CCCCCCC(NS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39NO2SSi/c1-4-5-6-16-27-33(29-17-10-7-11-18-29,34-37(35,36)30-25-23-28(2)24-26-30)38(3,31-19-12-8-13-20-31)32-21-14-9-15-22-32/h7-15,17-26,34H,4-6,16,27H2,1-3H3 |
| InChIKey | XKPVFVOEAIYLNE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|