C23H40O3S — CID 154162369
9-phenylheptadecane-9-sulfonic acid (PubChem CID 154162369) has the molecular formula C23H40O3S and a molecular weight of 396.64 g/mol. Its IUPAC name is 9-phenylheptadecane-9-sulfonic acid.
| Compound Name | 9-phenylheptadecane-9-sulfonic acid |
|---|---|
| PubChem CID | 154162369 |
| Molecular Formula | C23H40O3S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 9-phenylheptadecane-9-sulfonic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C23H40O3S/c1-3-5-7-9-11-16-20-23(27(24,25)26,22-18-14-13-15-19-22)21-17-12-10-8-6-4-2/h13-15,18-19H,3-12,16-17,20-21H2,1-2H3,(H,24,25,26) |
| InChIKey | BRDWWBLJWGTGIN-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|