C17H24O3S — CID 138723246
5-phenylundec-3-yne-5-sulfonic acid (PubChem CID 138723246) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 5-phenylundec-3-yne-5-sulfonic acid.
| Compound Name | 5-phenylundec-3-yne-5-sulfonic acid |
|---|---|
| PubChem CID | 138723246 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-phenylundec-3-yne-5-sulfonic acid |
| SMILES | CCC#CC(CCCCCC)(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C17H24O3S/c1-3-5-7-11-15-17(14-6-4-2,21(18,19)20)16-12-9-8-10-13-16/h8-10,12-13H,3-5,7,11,15H2,1-2H3,(H,18,19,20) |
| InChIKey | XTCBRRLOJMDYRO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|