C24H28NO5PS — CID 15852324
N-[diethoxyphosphoryl(diphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 15852324) has the molecular formula C24H28NO5PS and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(diphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[diethoxyphosphoryl(diphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 15852324 |
| Molecular Formula | C24H28NO5PS |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[diethoxyphosphoryl(diphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28NO5PS/c1-4-29-31(26,30-5-2)24(21-12-8-6-9-13-21,22-14-10-7-11-15-22)25-32(27,28)23-18-16-20(3)17-19-23/h6-19,25H,4-5H2,1-3H3 |
| InChIKey | QGNPSMHIPZLSFJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|