C18H22F2NO5PS — CID 86605697
N-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]benzenesulfonamide (PubChem CID 86605697) has the molecular formula C18H22F2NO5PS and a molecular weight of 433.41 g/mol. Its IUPAC name is N-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86605697 |
| Molecular Formula | C18H22F2NO5PS |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(CNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22F2NO5PS/c1-3-25-27(22,26-4-2)18(19,20)16-12-10-15(11-13-16)14-21-28(23,24)17-8-6-5-7-9-17/h5-13,21H,3-4,14H2,1-2H3 |
| InChIKey | HNARIZSHCGJNHL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|