C11H17FO8P2S — CID 54283121
(benzenesulfonyl-diethoxyphosphoryl-fluoromethyl)phosphonic acid (PubChem CID 54283121) has the molecular formula C11H17FO8P2S and a molecular weight of 390.26 g/mol. Its IUPAC name is (benzenesulfonyl-diethoxyphosphoryl-fluoromethyl)phosphonic acid.
| Compound Name | (benzenesulfonyl-diethoxyphosphoryl-fluoromethyl)phosphonic acid |
|---|---|
| PubChem CID | 54283121 |
| Molecular Formula | C11H17FO8P2S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | (benzenesulfonyl-diethoxyphosphoryl-fluoromethyl)phosphonic acid |
| SMILES | CCOP(=O)(OCC)C(F)(P(=O)(O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H17FO8P2S/c1-3-19-22(16,20-4-2)11(12,21(13,14)15)23(17,18)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H2,13,14,15) |
| InChIKey | RSELCSIODXFDKF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|