C10H12F3O5PS — CID 154620403
[benzyl(ethoxy)phosphoryl] trifluoromethanesulfonate (PubChem CID 154620403) has the molecular formula C10H12F3O5PS and a molecular weight of 334.24 g/mol. Its IUPAC name is [benzyl(ethoxy)phosphoryl] trifluoromethanesulfonate.
| Compound Name | [benzyl(ethoxy)phosphoryl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154620403 |
| Molecular Formula | C10H12F3O5PS |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | [benzyl(ethoxy)phosphoryl] trifluoromethanesulfonate |
| SMILES | CCOP(=O)(Cc1ccccc1)[18O]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3O5PS/c1-2-17-19(14,8-9-6-4-3-5-7-9)18-20(15,16)10(11,12)13/h3-7H,2,8H2,1H3/i18+2 |
| InChIKey | QGNFZBJPZTXGSJ-GTFORLLLSA-N |
| XLogP | 3.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|