C18H25F5O6P2 — CID 174954785
[3,3-bis(diethoxyphosphoryl)-1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]benzene (PubChem CID 174954785) has the molecular formula C18H25F5O6P2 and a molecular weight of 494.33 g/mol. Its IUPAC name is [3,3-bis(diethoxyphosphoryl)-1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]benzene.
| Compound Name | [3,3-bis(diethoxyphosphoryl)-1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]benzene |
|---|---|
| PubChem CID | 174954785 |
| Molecular Formula | C18H25F5O6P2 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [3,3-bis(diethoxyphosphoryl)-1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]benzene |
| SMILES | CCOP(=O)(OCC)C(=C(C(F)(F)F)C(F)(F)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H25F5O6P2/c1-5-26-30(24,27-6-2)16(31(25,28-7-3)29-8-4)15(18(21,22)23)17(19,20)14-12-10-9-11-13-14/h9-13H,5-8H2,1-4H3 |
| InChIKey | JHAIPMXCBWITJU-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|