C14H18Cl2NO4P — CID 7090611
N-(2,2-dichloro-1-diethoxyphosphorylethenyl)-2-phenylacetamide (PubChem CID 7090611) has the molecular formula C14H18Cl2NO4P and a molecular weight of 366.18 g/mol. Its IUPAC name is N-(2,2-dichloro-1-diethoxyphosphorylethenyl)-2-phenylacetamide.
| Compound Name | N-(2,2-dichloro-1-diethoxyphosphorylethenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7090611 |
| Molecular Formula | C14H18Cl2NO4P |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-(2,2-dichloro-1-diethoxyphosphorylethenyl)-2-phenylacetamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)Cc1ccccc1)=C(Cl)Cl |
| InChI | InChI=1S/C14H18Cl2NO4P/c1-3-20-22(19,21-4-2)14(13(15)16)17-12(18)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,17,18) |
| InChIKey | DQJFIOKHOMPAMO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|