C13H15NO5 — CID 2416190
[2-oxo-2-[(2-phenylacetyl)amino]ethyl] 2-methoxyacetate (PubChem CID 2416190) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 2-methoxyacetate.
| Compound Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 2416190 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO5/c1-18-9-13(17)19-8-12(16)14-11(15)7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,14,15,16) |
| InChIKey | TYLXRWKYVSVXLC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |