C21H23FN2O6S — CID 30800283
[2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate (PubChem CID 30800283) has the molecular formula C21H23FN2O6S and a molecular weight of 450.49 g/mol. Its IUPAC name is [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate.
| Compound Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate |
|---|---|
| PubChem CID | 30800283 |
| Molecular Formula | C21H23FN2O6S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate |
| SMILES | CN(CCCC(=O)OCC(=O)NC(=O)Cc1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O6S/c1-24(31(28,29)18-11-9-17(22)10-12-18)13-5-8-21(27)30-15-20(26)23-19(25)14-16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13-15H2,1H3,(H,23,25,26) |
| InChIKey | DDMWUPUTFOBTRE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |