C23H24FN3O4S — CID 55878929
4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(6-phenylmethoxy-3-pyridinyl)butanamide (PubChem CID 55878929) has the molecular formula C23H24FN3O4S and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(6-phenylmethoxy-3-pyridinyl)butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(6-phenylmethoxy-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 55878929 |
| Molecular Formula | C23H24FN3O4S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(6-phenylmethoxy-3-pyridinyl)butanamide |
| SMILES | CN(CCCC(=O)Nc1ccc(OCc2ccccc2)nc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O4S/c1-27(32(29,30)21-12-9-19(24)10-13-21)15-5-8-22(28)26-20-11-14-23(25-16-20)31-17-18-6-3-2-4-7-18/h2-4,6-7,9-14,16H,5,8,15,17H2,1H3,(H,26,28) |
| InChIKey | VXYACENHYNCYFM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |