C20H23FN2O6S — CID 55708813
methyl 2-[4-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]phenoxy]acetate (PubChem CID 55708813) has the molecular formula C20H23FN2O6S and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 2-[4-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 55708813 |
| Molecular Formula | C20H23FN2O6S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | methyl 2-[4-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CCCN(C)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H23FN2O6S/c1-23(30(26,27)18-11-5-15(21)6-12-18)13-3-4-19(24)22-16-7-9-17(10-8-16)29-14-20(25)28-2/h5-12H,3-4,13-14H2,1-2H3,(H,22,24) |
| InChIKey | IFHZXGTVSVHPAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |