C17H15Cl3NO3P — CID 2305792
2-chloro-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide (PubChem CID 2305792) has the molecular formula C17H15Cl3NO3P and a molecular weight of 418.64 g/mol. Its IUPAC name is 2-chloro-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide.
| Compound Name | 2-chloro-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide |
|---|---|
| PubChem CID | 2305792 |
| Molecular Formula | C17H15Cl3NO3P |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2-chloro-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide |
| SMILES | CCOP(=O)(C(NC(=O)c1ccccc1Cl)=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl3NO3P/c1-2-24-25(23,12-8-4-3-5-9-12)17(15(19)20)21-16(22)13-10-6-7-11-14(13)18/h3-11H,2H2,1H3,(H,21,22) |
| InChIKey | VMAVKJVESZOFOO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|