C23H20Cl2NO3PS — CID 35453094
N-[(E)-2-chloro-2-(4-chlorophenyl)sulfanyl-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide (PubChem CID 35453094) has the molecular formula C23H20Cl2NO3PS and a molecular weight of 492.36 g/mol. Its IUPAC name is N-[(E)-2-chloro-2-(4-chlorophenyl)sulfanyl-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide.
| Compound Name | N-[(E)-2-chloro-2-(4-chlorophenyl)sulfanyl-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide |
|---|---|
| PubChem CID | 35453094 |
| Molecular Formula | C23H20Cl2NO3PS |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N-[(E)-2-chloro-2-(4-chlorophenyl)sulfanyl-1-[ethoxy(phenyl)phosphoryl]ethenyl]benzamide |
| SMILES | CCO[P@@](=O)(/C(NC(=O)c1ccccc1)=C(/Cl)Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H20Cl2NO3PS/c1-2-29-30(28,19-11-7-4-8-12-19)23(26-22(27)17-9-5-3-6-10-17)21(25)31-20-15-13-18(24)14-16-20/h3-16H,2H2,1H3,(H,26,27)/b23-21-/t30-/m1/s1 |
| InChIKey | NOZZBXWXLAHCBJ-HOQCJHPKSA-N |
| XLogP | 6.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|