C28H24Cl3NOPS+ — CID 126957815
[(Z)-1-acetamido-2-chloro-2-(4-chlorophenyl)sulfanylethenyl]-triphenylphosphanium;hydrochloride (PubChem CID 126957815) has the molecular formula C28H24Cl3NOPS+ and a molecular weight of 559.91 g/mol. Its IUPAC name is [(Z)-1-acetamido-2-chloro-2-(4-chlorophenyl)sulfanylethenyl]-triphenylphosphanium;hydrochloride.
| Compound Name | [(Z)-1-acetamido-2-chloro-2-(4-chlorophenyl)sulfanylethenyl]-triphenylphosphanium;hydrochloride |
|---|---|
| PubChem CID | 126957815 |
| Molecular Formula | C28H24Cl3NOPS+ |
| Molecular Weight | 559.91 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | [(Z)-1-acetamido-2-chloro-2-(4-chlorophenyl)sulfanylethenyl]-triphenylphosphanium;hydrochloride |
| SMILES | CC(=O)N/C(=C(/Cl)Sc1ccc(Cl)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C28H22Cl2NOPS.ClH/c1-21(32)31-28(27(30)34-26-19-17-22(29)18-20-26)33(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25;/h2-20H,1H3;1H/p+1/b28-27+; |
| InChIKey | LKVLXBYPGDTGCJ-RXQWRGDBSA-O |
| XLogP | 7.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.91 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|