C28H24ClNOPS2+ — CID 2830295
[(E)-1-acetamido-2-(4-chlorophenyl)sulfanyl-2-sulfanylethenyl]-triphenylphosphanium (PubChem CID 2830295) has the molecular formula C28H24ClNOPS2+ and a molecular weight of 521.07 g/mol. Its IUPAC name is [(E)-1-acetamido-2-(4-chlorophenyl)sulfanyl-2-sulfanylethenyl]-triphenylphosphanium.
| Compound Name | [(E)-1-acetamido-2-(4-chlorophenyl)sulfanyl-2-sulfanylethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 2830295 |
| Molecular Formula | C28H24ClNOPS2+ |
| Molecular Weight | 521.07 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | [(E)-1-acetamido-2-(4-chlorophenyl)sulfanyl-2-sulfanylethenyl]-triphenylphosphanium |
| SMILES | CC(=O)N/C(=C(/S)Sc1ccc(Cl)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23ClNOPS2/c1-21(31)30-27(28(33)34-26-19-17-22(29)18-20-26)32(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3,(H-,30,31,33)/p+1/b28-27+ |
| InChIKey | UUIZBKDBTGTOSI-BYYHNAKLSA-O |
| XLogP | 6.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.07 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|