C22H20Cl2NO6P — CID 45046059
[(Z)-2-chloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium perchlorate (PubChem CID 45046059) has the molecular formula C22H20Cl2NO6P and a molecular weight of 496.28 g/mol. Its IUPAC name is [(Z)-2-chloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium perchlorate.
| Compound Name | [(Z)-2-chloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 45046059 |
| Molecular Formula | C22H20Cl2NO6P |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | [(Z)-2-chloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium perchlorate |
| SMILES | COC(=O)N/C(=C/Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H19ClNO2P.ClHO4/c1-26-22(25)24-21(17-23)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;2-1(3,4)5/h2-17H,1H3;(H,2,3,4,5)/b21-17-; |
| InChIKey | HDOPSOXJEFRSOZ-BMEBGVJCSA-N |
| XLogP | -0.38 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|