C29H27ClNO5PS — CID 71952488
(1-benzamido-2-ethylsulfanylethenyl)-triphenylphosphanium perchlorate (PubChem CID 71952488) has the molecular formula C29H27ClNO5PS and a molecular weight of 568.03 g/mol. Its IUPAC name is (1-benzamido-2-ethylsulfanylethenyl)-triphenylphosphanium perchlorate.
| Compound Name | (1-benzamido-2-ethylsulfanylethenyl)-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 71952488 |
| Molecular Formula | C29H27ClNO5PS |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | (1-benzamido-2-ethylsulfanylethenyl)-triphenylphosphanium perchlorate |
| SMILES | CCSC=C(NC(=O)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H26NOPS.ClHO4/c1-2-33-23-28(30-29(31)24-15-7-3-8-16-24)32(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27;2-1(3,4)5/h3-23H,2H2,1H3;(H,2,3,4,5) |
| InChIKey | OLNNSYJOHZOMHL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|