C30H27NO3PS+ — CID 71951271
[2-(carboxymethylsulfanyl)-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium (PubChem CID 71951271) has the molecular formula C30H27NO3PS+ and a molecular weight of 512.59 g/mol. Its IUPAC name is [2-(carboxymethylsulfanyl)-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium.
| Compound Name | [2-(carboxymethylsulfanyl)-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 71951271 |
| Molecular Formula | C30H27NO3PS+ |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [2-(carboxymethylsulfanyl)-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium |
| SMILES | Cc1ccc(C(=O)NC(=CSCC(=O)O)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26NO3PS/c1-23-17-19-24(20-18-23)30(34)31-28(21-36-22-29(32)33)35(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-21H,22H2,1H3,(H-,31,32,33,34)/p+1 |
| InChIKey | DISYDHHYHVJDEJ-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|