C28H23Cl3NOP — CID 11964917
[2,2-dichloro-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium chloride (PubChem CID 11964917) has the molecular formula C28H23Cl3NOP and a molecular weight of 526.83 g/mol. Its IUPAC name is [2,2-dichloro-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium chloride.
| Compound Name | [2,2-dichloro-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 11964917 |
| Molecular Formula | C28H23Cl3NOP |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | [2,2-dichloro-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium chloride |
| SMILES | Cc1ccc(C(=O)NC(=C(Cl)Cl)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C28H22Cl2NOP.ClH/c1-21-17-19-22(20-18-21)27(32)31-28(26(29)30)33(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25;/h2-20H,1H3;1H |
| InChIKey | FNZIJSSKNCWVOM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|