C27H22Cl3NO5P+ — CID 126959055
(1-benzamido-2,2-dichloroethenyl)-triphenylphosphanium;perchloric acid (PubChem CID 126959055) has the molecular formula C27H22Cl3NO5P+ and a molecular weight of 577.81 g/mol. Its IUPAC name is (1-benzamido-2,2-dichloroethenyl)-triphenylphosphanium;perchloric acid.
| Compound Name | (1-benzamido-2,2-dichloroethenyl)-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126959055 |
| Molecular Formula | C27H22Cl3NO5P+ |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 576.03 |
| IUPAC Name | (1-benzamido-2,2-dichloroethenyl)-triphenylphosphanium;perchloric acid |
| SMILES | O=C(NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C27H20Cl2NOP.ClHO4/c28-25(29)27(30-26(31)21-13-5-1-6-14-21)32(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;2-1(3,4)5/h1-20H;(H,2,3,4,5)/p+1 |
| InChIKey | UOPNBZBUTFDWSB-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|