C29H24Cl2NO7P — CID 75366372
[(E)-2-benzamido-1-chloro-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate (PubChem CID 75366372) has the molecular formula C29H24Cl2NO7P and a molecular weight of 600.39 g/mol. Its IUPAC name is [(E)-2-benzamido-1-chloro-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate.
| Compound Name | [(E)-2-benzamido-1-chloro-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 75366372 |
| Molecular Formula | C29H24Cl2NO7P |
| Molecular Weight | 600.39 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | [(E)-2-benzamido-1-chloro-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
| SMILES | COC(=O)/C(NC(=O)c1ccccc1)=C(\Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H23ClNO3P.ClHO4/c1-34-29(33)26(31-28(32)22-14-6-2-7-15-22)27(30)35(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25;2-1(3,4)5/h2-21H,1H3;(H,2,3,4,5)/b27-26-; |
| InChIKey | RFNZDVVDHCTIOK-JTHROIFXSA-N |
| XLogP | 0.24 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|