C34H26Cl2N2O2P+ — CID 45136449
[(E)-2-benzamido-1-chloro-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium (PubChem CID 45136449) has the molecular formula C34H26Cl2N2O2P+ and a molecular weight of 596.47 g/mol. Its IUPAC name is [(E)-2-benzamido-1-chloro-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium.
| Compound Name | [(E)-2-benzamido-1-chloro-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 45136449 |
| Molecular Formula | C34H26Cl2N2O2P+ |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | [(E)-2-benzamido-1-chloro-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
| SMILES | O=C(Nc1ccc(Cl)cc1)/C(NC(=O)c1ccccc1)=C(\Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H25Cl2N2O2P/c35-26-21-23-27(24-22-26)37-34(40)31(38-33(39)25-13-5-1-6-14-25)32(36)41(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-24H,(H-,37,38,39,40)/p+1/b32-31- |
| InChIKey | AQHZPYVNDFQGTM-MVJHLKBCSA-O |
| XLogP | 7.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|