C35H30N2O2PS+ — CID 6217459
[(E)-2-benzamido-3-(4-methylanilino)-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium (PubChem CID 6217459) has the molecular formula C35H30N2O2PS+ and a molecular weight of 573.68 g/mol. Its IUPAC name is [(E)-2-benzamido-3-(4-methylanilino)-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium.
| Compound Name | [(E)-2-benzamido-3-(4-methylanilino)-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 6217459 |
| Molecular Formula | C35H30N2O2PS+ |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | [(E)-2-benzamido-3-(4-methylanilino)-3-oxo-1-sulfanylprop-1-enyl]-triphenylphosphanium |
| SMILES | Cc1ccc(NC(=O)/C(NC(=O)c2ccccc2)=C(\S)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H29N2O2PS/c1-26-22-24-28(25-23-26)36-34(39)32(37-33(38)27-14-6-2-7-15-27)35(41)40(29-16-8-3-9-17-29,30-18-10-4-11-19-30)31-20-12-5-13-21-31/h2-25H,1H3,(H2-,36,37,38,39,41)/p+1 |
| InChIKey | PZCXCGLZWADTEU-UHFFFAOYSA-O |
| XLogP | 6.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|