C29H27NOPS2+ — CID 3090277
[1-benzamido-2,2-bis(methylsulfanyl)ethenyl]-triphenylphosphanium (PubChem CID 3090277) has the molecular formula C29H27NOPS2+ and a molecular weight of 500.65 g/mol. Its IUPAC name is [1-benzamido-2,2-bis(methylsulfanyl)ethenyl]-triphenylphosphanium.
| Compound Name | [1-benzamido-2,2-bis(methylsulfanyl)ethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3090277 |
| Molecular Formula | C29H27NOPS2+ |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | [1-benzamido-2,2-bis(methylsulfanyl)ethenyl]-triphenylphosphanium |
| SMILES | CSC(SC)=C(NC(=O)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26NOPS2/c1-33-29(34-2)28(30-27(31)23-15-7-3-8-16-23)32(24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3/p+1 |
| InChIKey | DNDNMLOYAQSXRY-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|