C33H25Cl2FNO5P — CID 90489741
[(Z)-1-benzamido-2-chloro-2-(4-fluorophenyl)ethenyl]-triphenylphosphanium perchlorate (PubChem CID 90489741) has the molecular formula C33H25Cl2FNO5P and a molecular weight of 636.44 g/mol. Its IUPAC name is [(Z)-1-benzamido-2-chloro-2-(4-fluorophenyl)ethenyl]-triphenylphosphanium perchlorate.
| Compound Name | [(Z)-1-benzamido-2-chloro-2-(4-fluorophenyl)ethenyl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 90489741 |
| Molecular Formula | C33H25Cl2FNO5P |
| Molecular Weight | 636.44 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | [(Z)-1-benzamido-2-chloro-2-(4-fluorophenyl)ethenyl]-triphenylphosphanium perchlorate |
| SMILES | O=C(N/C(=C(/Cl)c1ccc(F)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C33H24ClFNOP.ClHO4/c34-31(25-21-23-27(35)24-22-25)33(36-32(37)26-13-5-1-6-14-26)38(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30;2-1(3,4)5/h1-24H;(H,2,3,4,5)/b33-31-; |
| InChIKey | BLPNKCHWLQXAFV-HDAORCIOSA-N |
| XLogP | 2.36 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|