C34H27Cl3NOPS — CID 44657111
[(Z)-2-chloro-1-[(4-chlorobenzoyl)amino]-2-(4-methylphenyl)sulfanylethenyl]-triphenylphosphanium chloride (PubChem CID 44657111) has the molecular formula C34H27Cl3NOPS and a molecular weight of 635.00 g/mol. Its IUPAC name is [(Z)-2-chloro-1-[(4-chlorobenzoyl)amino]-2-(4-methylphenyl)sulfanylethenyl]-triphenylphosphanium chloride.
| Compound Name | [(Z)-2-chloro-1-[(4-chlorobenzoyl)amino]-2-(4-methylphenyl)sulfanylethenyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 44657111 |
| Molecular Formula | C34H27Cl3NOPS |
| Molecular Weight | 635.00 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | [(Z)-2-chloro-1-[(4-chlorobenzoyl)amino]-2-(4-methylphenyl)sulfanylethenyl]-triphenylphosphanium chloride |
| SMILES | Cc1ccc(S/C(Cl)=C(\NC(=O)c2ccc(Cl)cc2)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C34H26Cl2NOPS.ClH/c1-25-17-23-31(24-18-25)40-32(36)34(37-33(38)26-19-21-27(35)22-20-26)39(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30;/h2-24H,1H3;1H/b34-32+; |
| InChIKey | OYODPVAPVMXQHM-FSTCSSKCSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|