C31H28ClNO3PS+ — CID 71951269
[2-chloro-2-(2-methoxy-2-oxoethyl)sulfanyl-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium (PubChem CID 71951269) has the molecular formula C31H28ClNO3PS+ and a molecular weight of 561.06 g/mol. Its IUPAC name is [2-chloro-2-(2-methoxy-2-oxoethyl)sulfanyl-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium.
| Compound Name | [2-chloro-2-(2-methoxy-2-oxoethyl)sulfanyl-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 71951269 |
| Molecular Formula | C31H28ClNO3PS+ |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | [2-chloro-2-(2-methoxy-2-oxoethyl)sulfanyl-1-[(4-methylbenzoyl)amino]ethenyl]-triphenylphosphanium |
| SMILES | COC(=O)CSC(Cl)=C(NC(=O)c1ccc(C)cc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27ClNO3PS/c1-23-18-20-24(21-19-23)30(35)33-31(29(32)38-22-28(34)36-2)37(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-21H,22H2,1-2H3/p+1 |
| InChIKey | JZMAPEXAWCUUEI-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|