C13H15Cl2NO3S — CID 45142517
methyl 2-[2,2-dichloro-1-[(4-methylbenzoyl)amino]ethyl]sulfanylacetate (PubChem CID 45142517) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is methyl 2-[2,2-dichloro-1-[(4-methylbenzoyl)amino]ethyl]sulfanylacetate.
| Compound Name | methyl 2-[2,2-dichloro-1-[(4-methylbenzoyl)amino]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 45142517 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | methyl 2-[2,2-dichloro-1-[(4-methylbenzoyl)amino]ethyl]sulfanylacetate |
| SMILES | COC(=O)CSC(NC(=O)c1ccc(C)cc1)C(Cl)Cl |
| InChI | InChI=1S/C13H15Cl2NO3S/c1-8-3-5-9(6-4-8)12(18)16-13(11(14)15)20-7-10(17)19-2/h3-6,11,13H,7H2,1-2H3,(H,16,18) |
| InChIKey | AMURTCHSAWZBBY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|