C17H17Cl2NOS — CID 45142514
N-(1-benzylsulfanyl-2,2-dichloroethyl)-4-methylbenzamide (PubChem CID 45142514) has the molecular formula C17H17Cl2NOS and a molecular weight of 354.30 g/mol. Its IUPAC name is N-(1-benzylsulfanyl-2,2-dichloroethyl)-4-methylbenzamide.
| Compound Name | N-(1-benzylsulfanyl-2,2-dichloroethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 45142514 |
| Molecular Formula | C17H17Cl2NOS |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(1-benzylsulfanyl-2,2-dichloroethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(SCc2ccccc2)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NOS/c1-12-7-9-14(10-8-12)16(21)20-17(15(18)19)22-11-13-5-3-2-4-6-13/h2-10,15,17H,11H2,1H3,(H,20,21) |
| InChIKey | RPAGMXSRLNXPQX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|