C16H14Cl3NOS — CID 45142516
N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]-4-methylbenzamide (PubChem CID 45142516) has the molecular formula C16H14Cl3NOS and a molecular weight of 374.72 g/mol. Its IUPAC name is N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]-4-methylbenzamide.
| Compound Name | N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 45142516 |
| Molecular Formula | C16H14Cl3NOS |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(Sc2ccc(Cl)cc2)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3NOS/c1-10-2-4-11(5-3-10)15(21)20-16(14(18)19)22-13-8-6-12(17)7-9-13/h2-9,14,16H,1H3,(H,20,21) |
| InChIKey | FMXFMMGKWJYXJT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|