C28H24ClNOS — CID 46763987
4-[(4-chlorophenyl)sulfanylmethyl]-N-[(4-methylphenyl)-phenylmethyl]benzamide (PubChem CID 46763987) has the molecular formula C28H24ClNOS and a molecular weight of 458.03 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(4-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(4-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 46763987 |
| Molecular Formula | C28H24ClNOS |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[(4-methylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc(C(NC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24ClNOS/c1-20-7-11-23(12-8-20)27(22-5-3-2-4-6-22)30-28(31)24-13-9-21(10-14-24)19-32-26-17-15-25(29)16-18-26/h2-18,27H,19H2,1H3,(H,30,31) |
| InChIKey | YEKRFQFLCPAYPF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |