C30H28N2O2S — CID 3950868
2-[[4-[(4-methylphenyl)sulfanylmethyl]benzoyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 3950868) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)sulfanylmethyl]benzoyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[[4-[(4-methylphenyl)sulfanylmethyl]benzoyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3950868 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)sulfanylmethyl]benzoyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)Nc3ccccc3C(=O)NC(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O2S/c1-21-12-18-26(19-13-21)35-20-23-14-16-25(17-15-23)29(33)32-28-11-7-6-10-27(28)30(34)31-22(2)24-8-4-3-5-9-24/h3-19,22H,20H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | GNSAYCVPOWZYBE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |