C28H25NOS — CID 28632234
N-[(R)-(4-methylphenyl)-phenylmethyl]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 28632234) has the molecular formula C28H25NOS and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[(R)-(4-methylphenyl)-phenylmethyl]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(R)-(4-methylphenyl)-phenylmethyl]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 28632234 |
| Molecular Formula | C28H25NOS |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[(R)-(4-methylphenyl)-phenylmethyl]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | Cc1ccc([C@H](NC(=O)c2ccc(CSc3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NOS/c1-21-12-16-24(17-13-21)27(23-8-4-2-5-9-23)29-28(30)25-18-14-22(15-19-25)20-31-26-10-6-3-7-11-26/h2-19,27H,20H2,1H3,(H,29,30)/t27-/m1/s1 |
| InChIKey | NGZCKASINAEOLF-HHHXNRCGSA-N |
| XLogP | 6.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |