C25H27NOS — CID 28577439
N-[(1S)-3-methyl-1-phenylbutyl]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 28577439) has the molecular formula C25H27NOS and a molecular weight of 389.56 g/mol. Its IUPAC name is N-[(1S)-3-methyl-1-phenylbutyl]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(1S)-3-methyl-1-phenylbutyl]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 28577439 |
| Molecular Formula | C25H27NOS |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(1S)-3-methyl-1-phenylbutyl]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(CSc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NOS/c1-19(2)17-24(21-9-5-3-6-10-21)26-25(27)22-15-13-20(14-16-22)18-28-23-11-7-4-8-12-23/h3-16,19,24H,17-18H2,1-2H3,(H,26,27)/t24-/m0/s1 |
| InChIKey | FFQOZZIEJQHRSV-DEOSSOPVSA-N |
| XLogP | 6.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |