C26H29NO2S — CID 30387379
N-[(1S)-3-methyl-1-phenylbutyl]-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 30387379) has the molecular formula C26H29NO2S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[(1S)-3-methyl-1-phenylbutyl]-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-[(1S)-3-methyl-1-phenylbutyl]-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 30387379 |
| Molecular Formula | C26H29NO2S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[(1S)-3-methyl-1-phenylbutyl]-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(OCCSc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2S/c1-20(2)19-25(21-9-5-3-6-10-21)27-26(28)22-13-15-23(16-14-22)29-17-18-30-24-11-7-4-8-12-24/h3-16,20,25H,17-19H2,1-2H3,(H,27,28)/t25-/m0/s1 |
| InChIKey | BSJBFJOENZSAHH-VWLOTQADSA-N |
| XLogP | 6.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|