C26H30N2O3S — CID 43907434
N-(3-methyl-1-phenylbutyl)-4-[(N-methylsulfonylanilino)methyl]benzamide (PubChem CID 43907434) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-4-[(N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-4-[(N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 43907434 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-4-[(N-methylsulfonylanilino)methyl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(CN(c2ccccc2)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O3S/c1-20(2)18-25(22-10-6-4-7-11-22)27-26(29)23-16-14-21(15-17-23)19-28(32(3,30)31)24-12-8-5-9-13-24/h4-17,20,25H,18-19H2,1-3H3,(H,27,29) |
| InChIKey | NCDZLJDKKONFJU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |