C26H29FN2O3S — CID 94020257
4-[(2-fluorophenyl)methyl-methylsulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide (PubChem CID 94020257) has the molecular formula C26H29FN2O3S and a molecular weight of 468.59 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methyl-methylsulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide.
| Compound Name | 4-[(2-fluorophenyl)methyl-methylsulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 94020257 |
| Molecular Formula | C26H29FN2O3S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[(2-fluorophenyl)methyl-methylsulfonylamino]-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(N(Cc2ccccc2F)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29FN2O3S/c1-19(2)17-25(20-9-5-4-6-10-20)28-26(30)21-13-15-23(16-14-21)29(33(3,31)32)18-22-11-7-8-12-24(22)27/h4-16,19,25H,17-18H2,1-3H3,(H,28,30)/t25-/m0/s1 |
| InChIKey | WNAFRPZBCZEXSZ-VWLOTQADSA-N |
| XLogP | 5.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |