C21H28N2O3S — CID 46568326
N-(3-methyl-1-phenylbutyl)-4-(propan-2-ylsulfamoyl)benzamide (PubChem CID 46568326) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-4-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-4-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46568326 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-4-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(S(=O)(=O)NC(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-15(2)14-20(17-8-6-5-7-9-17)22-21(24)18-10-12-19(13-11-18)27(25,26)23-16(3)4/h5-13,15-16,20,23H,14H2,1-4H3,(H,22,24) |
| InChIKey | VLHBPPADZHZWFK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |