C21H26N2O3S — CID 27853449
4-(cyclopropylsulfamoyl)-N-[(1R)-3-methyl-1-phenylbutyl]benzamide (PubChem CID 27853449) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-[(1R)-3-methyl-1-phenylbutyl]benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-[(1R)-3-methyl-1-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 27853449 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-[(1R)-3-methyl-1-phenylbutyl]benzamide |
| SMILES | CC(C)C[C@@H](NC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15(2)14-20(16-6-4-3-5-7-16)22-21(24)17-8-12-19(13-9-17)27(25,26)23-18-10-11-18/h3-9,12-13,15,18,20,23H,10-11,14H2,1-2H3,(H,22,24)/t20-/m1/s1 |
| InChIKey | SPHHCQKWDFWYAZ-HXUWFJFHSA-N |
| XLogP | 3.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |