C24H25NOS — CID 28633748
2-[(4-methylphenyl)methylsulfanyl]-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide (PubChem CID 28633748) has the molecular formula C24H25NOS and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfanyl]-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[(4-methylphenyl)methylsulfanyl]-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 28633748 |
| Molecular Formula | C24H25NOS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfanyl]-N-[(R)-(4-methylphenyl)-phenylmethyl]acetamide |
| SMILES | Cc1ccc(CSCC(=O)N[C@H](c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NOS/c1-18-8-12-20(13-9-18)16-27-17-23(26)25-24(21-6-4-3-5-7-21)22-14-10-19(2)11-15-22/h3-15,24H,16-17H2,1-2H3,(H,25,26)/t24-/m1/s1 |
| InChIKey | XWBKSSSFNAOWQZ-XMMPIXPASA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |