C22H19Cl2NOS — CID 7948805
N-[(1R)-1-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 7948805) has the molecular formula C22H19Cl2NOS and a molecular weight of 416.37 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 7948805 |
| Molecular Formula | C22H19Cl2NOS |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2NOS/c1-15(17-6-8-19(23)9-7-17)25-22(26)18-4-2-16(3-5-18)14-27-21-12-10-20(24)11-13-21/h2-13,15H,14H2,1H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | HXPKBRQSUYUNJA-OAHLLOKOSA-N |
| XLogP | 6.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |